4-BROMO-2,3-DIFLUOROBENZOIC ACID
4-Bromo-2,3-Difluorobenzoic Acid
CAS: 194804-91-6
Molecular Formula: C7H3BrF2O2
4-BROMO-2,3-DIFLUOROBENZOIC ACID - Names and Identifiers
| Name | 4-Bromo-2,3-Difluorobenzoic Acid |
| Synonyms | 180003 4-BROMO-2,3-DIFLUOROBENZOIC ACID 4-Bromo-2,3-Difluorobenzoic Acid Benzoic acid, 4-bromo-2,3-difluoro- 4-BROMO-2,3-DIFLUORO BENZENECARBOXYLIC ACID 4-Bromo-2,3-Difluoro Benzenecarboxylic Acid |
| CAS | 194804-91-6 |
| InChI | InChI=1/C7H3BrF2O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H,11,12) |
4-BROMO-2,3-DIFLUOROBENZOIC ACID - Physico-chemical Properties
| Molecular Formula | C7H3BrF2O2 |
| Molar Mass | 237 |
| Density | 1.872 |
| Boling Point | 288℃ |
| Flash Point | 128℃ |
| Vapor Presure | 0.0011mmHg at 25°C |
| pKa | 2.70±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.558 |
4-BROMO-2,3-DIFLUOROBENZOIC ACID - Risk and Safety
| UN IDs | UN2811 |
4-BROMO-2,3-DIFLUOROBENZOIC ACID - Introduction
4-Bromo-2,3-Difluorobenzoic Acid, chemical formula C7H4BrF2O2, is an organic compound. The following is an introduction to some of its properties, uses, methods and safety information:
Nature:
1. Appearance: 4-Bromo-2,3-Difluorobenzoic Acid is white crystal powder.
2. Melting Point: about 156-158 ° C.
3. Solubility: It has good solubility in most organic solvents.
Use:
4-Bromo-2,3-Difluorobenzoic Acid is widely used in organic synthesis and has the following common uses:
1. As a drug intermediate: It can be used as an intermediate for the synthesis of active compounds such as drugs, pesticides and pigments.
2. As a photosensitive dye: it can be used to prepare photosensitive materials for paper and textiles.
3. As a chemical synthesis reagent: it can be used for the halogenation reaction of carbonyl compounds in organic synthesis reactions.
Method:
4-Bromo-2,3-Difluorobenzoic Acid can be prepared by the following method:
1. React 2,3-difluorobenzoic Acid with bromine to generate 4-Bromo-2,3-Difluorobenzoic Acid.
Safety Information:
1. 4-Bromo-2,3-Difluorobenzoic Acid is an organic compound, and care should be taken to prevent it from contacting the skin and eyes. Appropriate protective equipment shall be worn during operation.
2. If accidentally come into contact with the skin, should immediately rinse with plenty of water, if necessary, seek medical help.
3. When using or storing, it should be kept in a dry and well-ventilated place to avoid contact with oxidants and other substances.
4. When handling this compound, correct operating procedures and personal protective measures should be followed to ensure safety.
Nature:
1. Appearance: 4-Bromo-2,3-Difluorobenzoic Acid is white crystal powder.
2. Melting Point: about 156-158 ° C.
3. Solubility: It has good solubility in most organic solvents.
Use:
4-Bromo-2,3-Difluorobenzoic Acid is widely used in organic synthesis and has the following common uses:
1. As a drug intermediate: It can be used as an intermediate for the synthesis of active compounds such as drugs, pesticides and pigments.
2. As a photosensitive dye: it can be used to prepare photosensitive materials for paper and textiles.
3. As a chemical synthesis reagent: it can be used for the halogenation reaction of carbonyl compounds in organic synthesis reactions.
Method:
4-Bromo-2,3-Difluorobenzoic Acid can be prepared by the following method:
1. React 2,3-difluorobenzoic Acid with bromine to generate 4-Bromo-2,3-Difluorobenzoic Acid.
Safety Information:
1. 4-Bromo-2,3-Difluorobenzoic Acid is an organic compound, and care should be taken to prevent it from contacting the skin and eyes. Appropriate protective equipment shall be worn during operation.
2. If accidentally come into contact with the skin, should immediately rinse with plenty of water, if necessary, seek medical help.
3. When using or storing, it should be kept in a dry and well-ventilated place to avoid contact with oxidants and other substances.
4. When handling this compound, correct operating procedures and personal protective measures should be followed to ensure safety.
Last Update：2024-04-09 15:17:54
